C26H40O4 — CID 167224148
methyl (4R)-4-[(3R,10R,13R)-3-hydroxy-10,13-dimethyl-6-methylidene-7-oxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate (PubChem CID 167224148) has the molecular formula C26H40O4 and a molecular weight of 416.60 g/mol. Its IUPAC name is methyl (4R)-4-[(3R,10R,13R)-3-hydroxy-10,13-dimethyl-6-methylidene-7-oxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate.
| Compound Name | methyl (4R)-4-[(3R,10R,13R)-3-hydroxy-10,13-dimethyl-6-methylidene-7-oxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
|---|---|
| PubChem CID | 167224148 |
| Molecular Formula | C26H40O4 |
| Molecular Weight | 416.60 g/mol |
| Exact Mass | 416.29 |
| IUPAC Name | methyl (4R)-4-[(3R,10R,13R)-3-hydroxy-10,13-dimethyl-6-methylidene-7-oxo-2,3,4,5,8,9,11,12,14,15,16,17-dodecahydro-1H-cyclopenta[a]phenanthren-17-yl]pentanoate |
| SMILES | C=C1C(=O)C2C(CC[C@@]3(C)C2CCC3[C@H](C)CCC(=O)OC)[C@@]2(C)CC[C@@H](O)CC12 |
| InChI | InChI=1S/C26H40O4/c1-15(6-9-22(28)30-5)18-7-8-19-23-20(11-13-25(18,19)3)26(4)12-10-17(27)14-21(26)16(2)24(23)29/h15,17-21,23,27H,2,6-14H2,1,3-5H3/t15-,17-,18?,19?,20?,21?,23?,25-,26-/m1/s1 |
| InChIKey | XAFFHMVYOSIVJW-IPNPLUOVSA-N |
| XLogP | 4.94 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.60 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|