C18H12ClF3IN5O — CID 167224206
N-[1-[3-(5-chloropyrazin-2-yl)pyrazin-2-yl]ethyl]-3-iodo-5-(trifluoromethyl)benzamide (PubChem CID 167224206) has the molecular formula C18H12ClF3IN5O and a molecular weight of 533.68 g/mol. Its IUPAC name is N-[1-[3-(5-chloropyrazin-2-yl)pyrazin-2-yl]ethyl]-3-iodo-5-(trifluoromethyl)benzamide.
| Compound Name | N-[1-[3-(5-chloropyrazin-2-yl)pyrazin-2-yl]ethyl]-3-iodo-5-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 167224206 |
| Molecular Formula | C18H12ClF3IN5O |
| Molecular Weight | 533.68 g/mol |
| Exact Mass | 532.97 |
| IUPAC Name | N-[1-[3-(5-chloropyrazin-2-yl)pyrazin-2-yl]ethyl]-3-iodo-5-(trifluoromethyl)benzamide |
| SMILES | CC(NC(=O)c1cc(I)cc(C(F)(F)F)c1)c1nccnc1-c1cnc(Cl)cn1 |
| InChI | InChI=1S/C18H12ClF3IN5O/c1-9(15-16(25-3-2-24-15)13-7-27-14(19)8-26-13)28-17(29)10-4-11(18(20,21)22)6-12(23)5-10/h2-9H,1H3,(H,28,29) |
| InChIKey | AJWHUSWBRBHPJY-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 80.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.68 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|