C50H101N3O7 — CID 167224227
(dihexylamino) 10-[[10-(dihexylamino)oxy-10-oxodecyl]-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]amino]decanoate (PubChem CID 167224227) has the molecular formula C50H101N3O7 and a molecular weight of 856.37 g/mol. Its IUPAC name is (dihexylamino) 10-[[10-(dihexylamino)oxy-10-oxodecyl]-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]amino]decanoate.
| Compound Name | (dihexylamino) 10-[[10-(dihexylamino)oxy-10-oxodecyl]-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]amino]decanoate |
|---|---|
| PubChem CID | 167224227 |
| Molecular Formula | C50H101N3O7 |
| Molecular Weight | 856.37 g/mol |
| Exact Mass | 855.76 |
| IUPAC Name | (dihexylamino) 10-[[10-(dihexylamino)oxy-10-oxodecyl]-[2-[2-(2-hydroxyethoxy)ethoxy]ethyl]amino]decanoate |
| SMILES | CCCCCCN(CCCCCC)OC(=O)CCCCCCCCCN(CCCCCCCCCC(=O)ON(CCCCCC)CCCCCC)CCOCCOCCO |
| InChI | InChI=1S/C50H101N3O7/c1-5-9-13-31-39-52(40-32-14-10-6-2)59-49(55)35-27-23-19-17-21-25-29-37-51(43-45-57-47-48-58-46-44-54)38-30-26-22-18-20-24-28-36-50(56)60-53(41-33-15-11-7-3)42-34-16-12-8-4/h54H,5-48H2,1-4H3 |
| InChIKey | YRNPCMXYCAVPGO-UHFFFAOYSA-N |
| XLogP | 12.40 |
| TPSA | 101.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 50 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 856.37 |
| LogP ≤ 5 | 12.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|