C25H38O3Si — CID 16722457
2-trimethylsilylethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate (PubChem CID 16722457) has the molecular formula C25H38O3Si and a molecular weight of 414.66 g/mol. Its IUPAC name is 2-trimethylsilylethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate.
| Compound Name | 2-trimethylsilylethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
|---|---|
| PubChem CID | 16722457 |
| Molecular Formula | C25H38O3Si |
| Molecular Weight | 414.66 g/mol |
| Exact Mass | 414.26 |
| IUPAC Name | 2-trimethylsilylethyl (2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethyl-3-oxocyclohexen-1-yl)nona-2,4,6,8-tetraenoate |
| SMILES | CC1=C(/C=C/C(C)=C/C=C/C(C)=C/C(=O)OCC[Si](C)(C)C)C(C)(C)CCC1=O |
| InChI | InChI=1S/C25H38O3Si/c1-19(12-13-22-21(3)23(26)14-15-25(22,4)5)10-9-11-20(2)18-24(27)28-16-17-29(6,7)8/h9-13,18H,14-17H2,1-8H3/b11-9+,13-12+,19-10+,20-18+ |
| InChIKey | CMJLUUKNCVKYRC-BEWWYBSYSA-N |
| XLogP | 6.58 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.66 |
| LogP ≤ 5 | 6.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|