C24H25F2N5O2S — CID 167224712
3-amino-N-[(3R)-7-[(1R,4R)-2,5-diazabicyclo[2.2.2]octan-2-yl]-5,8-difluoro-3,4-dihydro-2H-chromen-3-yl]-6-methylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 167224712) has the molecular formula C24H25F2N5O2S and a molecular weight of 485.56 g/mol. Its IUPAC name is 3-amino-N-[(3R)-7-[(1R,4R)-2,5-diazabicyclo[2.2.2]octan-2-yl]-5,8-difluoro-3,4-dihydro-2H-chromen-3-yl]-6-methylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-amino-N-[(3R)-7-[(1R,4R)-2,5-diazabicyclo[2.2.2]octan-2-yl]-5,8-difluoro-3,4-dihydro-2H-chromen-3-yl]-6-methylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 167224712 |
| Molecular Formula | C24H25F2N5O2S |
| Molecular Weight | 485.56 g/mol |
| Exact Mass | 485.17 |
| IUPAC Name | 3-amino-N-[(3R)-7-[(1R,4R)-2,5-diazabicyclo[2.2.2]octan-2-yl]-5,8-difluoro-3,4-dihydro-2H-chromen-3-yl]-6-methylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1ccc2c(N)c(C(=O)N[C@H]3COc4c(F)c(N5C[C@H]6CC[C@@H]5CN6)cc(F)c4C3)sc2n1 |
| InChI | InChI=1S/C24H25F2N5O2S/c1-11-2-5-15-20(27)22(34-24(15)29-11)23(32)30-13-6-16-17(25)7-18(19(26)21(16)33-10-13)31-9-12-3-4-14(31)8-28-12/h2,5,7,12-14,28H,3-4,6,8-10,27H2,1H3,(H,30,32)/t12-,13-,14-/m1/s1 |
| InChIKey | ILQWTQVAYXKEFL-MGPQQGTHSA-N |
| XLogP | 3.14 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.56 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |