About 4-methyl-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine
4-methyl-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine (PubChem CID 167225032) has the molecular formula C12H23N
and a molecular weight of 181.32 g/mol. Its IUPAC name is 4-methyl-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine.
Molecular Properties
| Compound Name | 4-methyl-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine |
| PubChem CID | 167225032 |
| Molecular Formula | C12H23N |
| Molecular Weight | 181.32 g/mol |
| Exact Mass | 181.18 |
| IUPAC Name | 4-methyl-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine |
| SMILES | CC1=C(C(C)C)CN(C(C)C)CC1 |
| InChI | InChI=1S/C12H23N/c1-9(2)12-8-13(10(3)4)7-6-11(12)5/h9-10H,6-8H2,1-5H3 |
| InChIKey | GOBJPXNWPMZNBP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.32 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine?
The IUPAC name of 4-methyl-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine (CID 167225032) is 4-methyl-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine.
What is the SMILES notation for 4-methyl-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine?
The canonical SMILES for 4-methyl-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine is CC1=C(C(C)C)CN(C(C)C)CC1.
What is the InChIKey of 4-methyl-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine?
The InChIKey is GOBJPXNWPMZNBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H23N/c1-9(2)12-8-13(10(3)4)7-6-11(12)5/h9-10H,6-8H2,1-5H3.
What are the key properties of 4-methyl-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine?
4-methyl-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine has a molecular weight of 181.32 g/mol, XLogP of 3.07, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-1,5-di(propan-2-yl)-3,6-dihydro-2H-pyridine is sourced from PubChem (CID 167225032), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).