About (7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-3-yl)methanol
(7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-3-yl)methanol (PubChem CID 167225253) has the molecular formula C10H17N3O
and a molecular weight of 195.27 g/mol. Its IUPAC name is (7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-3-yl)methanol.
Molecular Properties
| Compound Name | (7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-3-yl)methanol |
| PubChem CID | 167225253 |
| Molecular Formula | C10H17N3O |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 195.14 |
| IUPAC Name | (7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-3-yl)methanol |
| SMILES | CC(C)N1CCn2c(cnc2CO)C1 |
| InChI | InChI=1S/C10H17N3O/c1-8(2)12-3-4-13-9(6-12)5-11-10(13)7-14/h5,8,14H,3-4,6-7H2,1-2H3 |
| InChIKey | FKWVRQMCQLRALB-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-3-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-3-yl)methanol?
The IUPAC name of (7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-3-yl)methanol (CID 167225253) is (7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-3-yl)methanol.
What is the SMILES notation for (7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-3-yl)methanol?
The canonical SMILES for (7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-3-yl)methanol is CC(C)N1CCn2c(cnc2CO)C1.
What is the InChIKey of (7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-3-yl)methanol?
The InChIKey is FKWVRQMCQLRALB-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N3O/c1-8(2)12-3-4-13-9(6-12)5-11-10(13)7-14/h5,8,14H,3-4,6-7H2,1-2H3.
What are the key properties of (7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-3-yl)methanol?
(7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-3-yl)methanol has a molecular weight of 195.27 g/mol, XLogP of 0.60, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (7-propan-2-yl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-3-yl)methanol is sourced from PubChem (CID 167225253), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).