C30H32ClFN6O3 — CID 167225566
[5-chloro-4-[4-(1-fluoro-6-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl)-2-methoxy-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]naphthalen-2-yl] 2,2-dimethylpropanoate (PubChem CID 167225566) has the molecular formula C30H32ClFN6O3 and a molecular weight of 579.08 g/mol. Its IUPAC name is [5-chloro-4-[4-(1-fluoro-6-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl)-2-methoxy-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]naphthalen-2-yl] 2,2-dimethylpropanoate.
| Compound Name | [5-chloro-4-[4-(1-fluoro-6-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl)-2-methoxy-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]naphthalen-2-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 167225566 |
| Molecular Formula | C30H32ClFN6O3 |
| Molecular Weight | 579.08 g/mol |
| Exact Mass | 578.22 |
| IUPAC Name | [5-chloro-4-[4-(1-fluoro-6-methyl-6,8-dihydro-5H-imidazo[1,5-a]pyrazin-7-yl)-2-methoxy-6,8-dihydro-5H-pyrido[3,4-d]pyrimidin-7-yl]naphthalen-2-yl] 2,2-dimethylpropanoate |
| SMILES | COc1nc2c(c(N3Cc4c(F)ncn4CC3C)n1)CCN(c1cc(OC(=O)C(C)(C)C)cc3cccc(Cl)c13)C2 |
| InChI | InChI=1S/C30H32ClFN6O3/c1-17-13-37-16-33-26(32)24(37)15-38(17)27-20-9-10-36(14-22(20)34-29(35-27)40-5)23-12-19(41-28(39)30(2,3)4)11-18-7-6-8-21(31)25(18)23/h6-8,11-12,16-17H,9-10,13-15H2,1-5H3 |
| InChIKey | GDRKKHZKIBNNMS-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 85.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.08 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|