C39H30N4O — CID 167225842
5-[(1Z)-buta-1,3-dienyl]-4,14,14-trimethyl-3-(4-phenylquinazolin-2-yl)-21-oxa-3,16-diazapentacyclo[11.8.0.02,6.07,12.015,20]henicosa-1(13),2(6),4,7,9,11,15(20),16,18-nonaene (PubChem CID 167225842) has the molecular formula C39H30N4O and a molecular weight of 570.70 g/mol. Its IUPAC name is 5-[(1Z)-buta-1,3-dienyl]-4,14,14-trimethyl-3-(4-phenylquinazolin-2-yl)-21-oxa-3,16-diazapentacyclo[11.8.0.02,6.07,12.015,20]henicosa-1(13),2(6),4,7,9,11,15(20),16,18-nonaene.
| Compound Name | 5-[(1Z)-buta-1,3-dienyl]-4,14,14-trimethyl-3-(4-phenylquinazolin-2-yl)-21-oxa-3,16-diazapentacyclo[11.8.0.02,6.07,12.015,20]henicosa-1(13),2(6),4,7,9,11,15(20),16,18-nonaene |
|---|---|
| PubChem CID | 167225842 |
| Molecular Formula | C39H30N4O |
| Molecular Weight | 570.70 g/mol |
| Exact Mass | 570.24 |
| IUPAC Name | 5-[(1Z)-buta-1,3-dienyl]-4,14,14-trimethyl-3-(4-phenylquinazolin-2-yl)-21-oxa-3,16-diazapentacyclo[11.8.0.02,6.07,12.015,20]henicosa-1(13),2(6),4,7,9,11,15(20),16,18-nonaene |
| SMILES | C=C/C=C\c1c(C)n(-c2nc(-c3ccccc3)c3ccccc3n2)c2c3c(c4ccccc4c12)C(C)(C)c1ncccc1O3 |
| InChI | InChI=1S/C39H30N4O/c1-5-6-17-26-24(2)43(38-41-30-21-13-12-20-29(30)34(42-38)25-15-8-7-9-16-25)35-32(26)27-18-10-11-19-28(27)33-36(35)44-31-22-14-23-40-37(31)39(33,3)4/h5-23H,1H2,2-4H3/b17-6- |
| InChIKey | QSMFAKQNYQJLJZ-FMQZQXMHSA-N |
| XLogP | 9.73 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.70 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|