C24H23F3N2O — CID 16722608
cyclopentyl-[1-[4-(trifluoromethyl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone (PubChem CID 16722608) has the molecular formula C24H23F3N2O and a molecular weight of 412.46 g/mol. Its IUPAC name is cyclopentyl-[1-[4-(trifluoromethyl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone.
| Compound Name | cyclopentyl-[1-[4-(trifluoromethyl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
|---|---|
| PubChem CID | 16722608 |
| Molecular Formula | C24H23F3N2O |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.18 |
| IUPAC Name | cyclopentyl-[1-[4-(trifluoromethyl)phenyl]-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]methanone |
| SMILES | O=C(C1CCCC1)N1CCc2c([nH]c3ccccc23)C1c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C24H23F3N2O/c25-24(26,27)17-11-9-15(10-12-17)22-21-19(18-7-3-4-8-20(18)28-21)13-14-29(22)23(30)16-5-1-2-6-16/h3-4,7-12,16,22,28H,1-2,5-6,13-14H2 |
| InChIKey | QTFGQDYUCSUYLN-UHFFFAOYSA-N |
| XLogP | 5.85 |
| TPSA | 36.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|