C36H48N6O4 — CID 167226370
8-[bis[(4-methoxyphenyl)methyl]amino]-6-butoxy-3-[(Z)-1-pyrrolidin-1-ylhex-3-enyl]-1,4-dihydropyrimido[5,4-d]pyrimidin-2-one (PubChem CID 167226370) has the molecular formula C36H48N6O4 and a molecular weight of 628.82 g/mol. Its IUPAC name is 8-[bis[(4-methoxyphenyl)methyl]amino]-6-butoxy-3-[(Z)-1-pyrrolidin-1-ylhex-3-enyl]-1,4-dihydropyrimido[5,4-d]pyrimidin-2-one.
| Compound Name | 8-[bis[(4-methoxyphenyl)methyl]amino]-6-butoxy-3-[(Z)-1-pyrrolidin-1-ylhex-3-enyl]-1,4-dihydropyrimido[5,4-d]pyrimidin-2-one |
|---|---|
| PubChem CID | 167226370 |
| Molecular Formula | C36H48N6O4 |
| Molecular Weight | 628.82 g/mol |
| Exact Mass | 628.37 |
| IUPAC Name | 8-[bis[(4-methoxyphenyl)methyl]amino]-6-butoxy-3-[(Z)-1-pyrrolidin-1-ylhex-3-enyl]-1,4-dihydropyrimido[5,4-d]pyrimidin-2-one |
| SMILES | CC/C=C\CC(N1CCCC1)N1Cc2nc(OCCCC)nc(N(Cc3ccc(OC)cc3)Cc3ccc(OC)cc3)c2NC1=O |
| InChI | InChI=1S/C36H48N6O4/c1-5-7-9-12-32(40-21-10-11-22-40)42-26-31-33(38-36(42)43)34(39-35(37-31)46-23-8-6-2)41(24-27-13-17-29(44-3)18-14-27)25-28-15-19-30(45-4)20-16-28/h7,9,13-20,32H,5-6,8,10-12,21-26H2,1-4H3,(H,38,43)/b9-7- |
| InChIKey | ILSHUPGMAJMUTA-CLFYSBASSA-N |
| XLogP | 7.01 |
| TPSA | 92.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.82 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|