C13H24N2 — CID 167226535
(2S,7aR)-N-methyl-7-methylidene-2-propan-2-yl-3,3a,4,5,6,7a-hexahydro-2H-indol-1-amine (PubChem CID 167226535) has the molecular formula C13H24N2 and a molecular weight of 208.35 g/mol. Its IUPAC name is (2S,7aR)-N-methyl-7-methylidene-2-propan-2-yl-3,3a,4,5,6,7a-hexahydro-2H-indol-1-amine.
| Compound Name | (2S,7aR)-N-methyl-7-methylidene-2-propan-2-yl-3,3a,4,5,6,7a-hexahydro-2H-indol-1-amine |
|---|---|
| PubChem CID | 167226535 |
| Molecular Formula | C13H24N2 |
| Molecular Weight | 208.35 g/mol |
| Exact Mass | 208.19 |
| IUPAC Name | (2S,7aR)-N-methyl-7-methylidene-2-propan-2-yl-3,3a,4,5,6,7a-hexahydro-2H-indol-1-amine |
| SMILES | C=C1CCCC2C[C@@H](C(C)C)N(NC)[C@@H]12 |
| InChI | InChI=1S/C13H24N2/c1-9(2)12-8-11-7-5-6-10(3)13(11)15(12)14-4/h9,11-14H,3,5-8H2,1-2,4H3/t11?,12-,13-/m0/s1 |
| InChIKey | RQYPHWSAAJVFSV-SPOOISQMSA-N |
| XLogP | 2.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.35 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|