C13H25IN2 — CID 167226853
4-iodo-3,4,5-trimethyl-1-(1-methylpyrrolidin-3-yl)piperidine (PubChem CID 167226853) has the molecular formula C13H25IN2 and a molecular weight of 336.26 g/mol. Its IUPAC name is 4-iodo-3,4,5-trimethyl-1-(1-methylpyrrolidin-3-yl)piperidine.
| Compound Name | 4-iodo-3,4,5-trimethyl-1-(1-methylpyrrolidin-3-yl)piperidine |
|---|---|
| PubChem CID | 167226853 |
| Molecular Formula | C13H25IN2 |
| Molecular Weight | 336.26 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 4-iodo-3,4,5-trimethyl-1-(1-methylpyrrolidin-3-yl)piperidine |
| SMILES | CC1CN(C2CCN(C)C2)CC(C)C1(C)I |
| InChI | InChI=1S/C13H25IN2/c1-10-7-16(8-11(2)13(10,3)14)12-5-6-15(4)9-12/h10-12H,5-9H2,1-4H3 |
| InChIKey | SXLLBIZBUQOANW-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.26 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|