C12H14N2O — CID 167226869
(1E,4E,5Z)-4-ethylidene-1-(1H-pyrazol-4-yl)hepta-1,5-dien-3-one (PubChem CID 167226869) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is (1E,4E,5Z)-4-ethylidene-1-(1H-pyrazol-4-yl)hepta-1,5-dien-3-one.
| Compound Name | (1E,4E,5Z)-4-ethylidene-1-(1H-pyrazol-4-yl)hepta-1,5-dien-3-one |
|---|---|
| PubChem CID | 167226869 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | (1E,4E,5Z)-4-ethylidene-1-(1H-pyrazol-4-yl)hepta-1,5-dien-3-one |
| SMILES | C/C=C\C(=C/C)C(=O)/C=C/c1cn[nH]c1 |
| InChI | InChI=1S/C12H14N2O/c1-3-5-11(4-2)12(15)7-6-10-8-13-14-9-10/h3-9H,1-2H3,(H,13,14)/b5-3-,7-6+,11-4+ |
| InChIKey | NKTHPMZQEWZFSV-LNITXKDSSA-N |
| XLogP | 2.51 |
| TPSA | 45.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|