About 1,2-dihydro-1,8-naphthyridin-2-ol
1,2-dihydro-1,8-naphthyridin-2-ol (PubChem CID 167227347) has the molecular formula C8H8N2O
and a molecular weight of 148.16 g/mol. Its IUPAC name is 1,2-dihydro-1,8-naphthyridin-2-ol.
Molecular Properties
| Compound Name | 1,2-dihydro-1,8-naphthyridin-2-ol |
| PubChem CID | 167227347 |
| Molecular Formula | C8H8N2O |
| Molecular Weight | 148.16 g/mol |
| Exact Mass | 148.06 |
| IUPAC Name | 1,2-dihydro-1,8-naphthyridin-2-ol |
| SMILES | OC1C=Cc2cccnc2N1 |
| InChI | InChI=1S/C8H8N2O/c11-7-4-3-6-2-1-5-9-8(6)10-7/h1-5,7,11H,(H,9,10) |
| InChIKey | SUWUBRDTHMVFGG-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.16 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,2-dihydro-1,8-naphthyridin-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,2-dihydro-1,8-naphthyridin-2-ol?
The IUPAC name of 1,2-dihydro-1,8-naphthyridin-2-ol (CID 167227347) is 1,2-dihydro-1,8-naphthyridin-2-ol.
What is the SMILES notation for 1,2-dihydro-1,8-naphthyridin-2-ol?
The canonical SMILES for 1,2-dihydro-1,8-naphthyridin-2-ol is OC1C=Cc2cccnc2N1.
What is the InChIKey of 1,2-dihydro-1,8-naphthyridin-2-ol?
The InChIKey is SUWUBRDTHMVFGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8N2O/c11-7-4-3-6-2-1-5-9-8(6)10-7/h1-5,7,11H,(H,9,10).
What are the key properties of 1,2-dihydro-1,8-naphthyridin-2-ol?
1,2-dihydro-1,8-naphthyridin-2-ol has a molecular weight of 148.16 g/mol, XLogP of 0.84, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,2-dihydro-1,8-naphthyridin-2-ol is sourced from PubChem (CID 167227347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).