About 3-[bis(prop-2-enyl)amino]-2,2-dichloropropanal
3-[bis(prop-2-enyl)amino]-2,2-dichloropropanal (PubChem CID 167227882) has the molecular formula C9H13Cl2NO
and a molecular weight of 222.11 g/mol. Its IUPAC name is 3-[bis(prop-2-enyl)amino]-2,2-dichloropropanal.
Molecular Properties
| Compound Name | 3-[bis(prop-2-enyl)amino]-2,2-dichloropropanal |
| PubChem CID | 167227882 |
| Molecular Formula | C9H13Cl2NO |
| Molecular Weight | 222.11 g/mol |
| Exact Mass | 221.04 |
| IUPAC Name | 3-[bis(prop-2-enyl)amino]-2,2-dichloropropanal |
| SMILES | C=CCN(CC=C)CC(Cl)(Cl)C=O |
| InChI | InChI=1S/C9H13Cl2NO/c1-3-5-12(6-4-2)7-9(10,11)8-13/h3-4,8H,1-2,5-7H2 |
| InChIKey | ABCKEUBHKWXNKN-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.11 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3-[bis(prop-2-enyl)amino]-2,2-dichloropropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[bis(prop-2-enyl)amino]-2,2-dichloropropanal?
The IUPAC name of 3-[bis(prop-2-enyl)amino]-2,2-dichloropropanal (CID 167227882) is 3-[bis(prop-2-enyl)amino]-2,2-dichloropropanal.
What is the SMILES notation for 3-[bis(prop-2-enyl)amino]-2,2-dichloropropanal?
The canonical SMILES for 3-[bis(prop-2-enyl)amino]-2,2-dichloropropanal is C=CCN(CC=C)CC(Cl)(Cl)C=O.
What is the InChIKey of 3-[bis(prop-2-enyl)amino]-2,2-dichloropropanal?
The InChIKey is ABCKEUBHKWXNKN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13Cl2NO/c1-3-5-12(6-4-2)7-9(10,11)8-13/h3-4,8H,1-2,5-7H2.
What are the key properties of 3-[bis(prop-2-enyl)amino]-2,2-dichloropropanal?
3-[bis(prop-2-enyl)amino]-2,2-dichloropropanal has a molecular weight of 222.11 g/mol, XLogP of 2.03, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[bis(prop-2-enyl)amino]-2,2-dichloropropanal is sourced from PubChem (CID 167227882), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).