C15H25N3O — CID 167229251
N-methyl-5-(2,4,4-trimethylhexan-2-yl)pyrazine-2-carboxamide (PubChem CID 167229251) has the molecular formula C15H25N3O and a molecular weight of 263.38 g/mol. Its IUPAC name is N-methyl-5-(2,4,4-trimethylhexan-2-yl)pyrazine-2-carboxamide.
| Compound Name | N-methyl-5-(2,4,4-trimethylhexan-2-yl)pyrazine-2-carboxamide |
|---|---|
| PubChem CID | 167229251 |
| Molecular Formula | C15H25N3O |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.20 |
| IUPAC Name | N-methyl-5-(2,4,4-trimethylhexan-2-yl)pyrazine-2-carboxamide |
| SMILES | CCC(C)(C)CC(C)(C)c1cnc(C(=O)NC)cn1 |
| InChI | InChI=1S/C15H25N3O/c1-7-14(2,3)10-15(4,5)12-9-17-11(8-18-12)13(19)16-6/h8-9H,7,10H2,1-6H3,(H,16,19) |
| InChIKey | RVFICQMVUYPHAO-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |