C10H15F3N2O3 — CID 167229386
(2S)-N-(2-prop-2-enoxyethyl)-2-[(2,2,2-trifluoroacetyl)amino]propanamide (PubChem CID 167229386) has the molecular formula C10H15F3N2O3 and a molecular weight of 268.23 g/mol. Its IUPAC name is (2S)-N-(2-prop-2-enoxyethyl)-2-[(2,2,2-trifluoroacetyl)amino]propanamide.
| Compound Name | (2S)-N-(2-prop-2-enoxyethyl)-2-[(2,2,2-trifluoroacetyl)amino]propanamide |
|---|---|
| PubChem CID | 167229386 |
| Molecular Formula | C10H15F3N2O3 |
| Molecular Weight | 268.23 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | (2S)-N-(2-prop-2-enoxyethyl)-2-[(2,2,2-trifluoroacetyl)amino]propanamide |
| SMILES | C=CCOCCNC(=O)[C@H](C)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C10H15F3N2O3/c1-3-5-18-6-4-14-8(16)7(2)15-9(17)10(11,12)13/h3,7H,1,4-6H2,2H3,(H,14,16)(H,15,17)/t7-/m0/s1 |
| InChIKey | SUQUKFRPXQNQAZ-ZETCQYMHSA-N |
| XLogP | 0.37 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.23 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|