About (4,4-difluorocyclohexyl)methyl N-ethylcarbamate
(4,4-difluorocyclohexyl)methyl N-ethylcarbamate (PubChem CID 167229449) has the molecular formula C10H17F2NO2
and a molecular weight of 221.25 g/mol. Its IUPAC name is (4,4-difluorocyclohexyl)methyl N-ethylcarbamate.
Molecular Properties
| Compound Name | (4,4-difluorocyclohexyl)methyl N-ethylcarbamate |
| PubChem CID | 167229449 |
| Molecular Formula | C10H17F2NO2 |
| Molecular Weight | 221.25 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | (4,4-difluorocyclohexyl)methyl N-ethylcarbamate |
| SMILES | CCNC(=O)OCC1CCC(F)(F)CC1 |
| InChI | InChI=1S/C10H17F2NO2/c1-2-13-9(14)15-7-8-3-5-10(11,12)6-4-8/h8H,2-7H2,1H3,(H,13,14) |
| InChIKey | NWFKFKOGXSDSKH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4,4-difluorocyclohexyl)methyl N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,4-difluorocyclohexyl)methyl N-ethylcarbamate?
The IUPAC name of (4,4-difluorocyclohexyl)methyl N-ethylcarbamate (CID 167229449) is (4,4-difluorocyclohexyl)methyl N-ethylcarbamate.
What is the SMILES notation for (4,4-difluorocyclohexyl)methyl N-ethylcarbamate?
The canonical SMILES for (4,4-difluorocyclohexyl)methyl N-ethylcarbamate is CCNC(=O)OCC1CCC(F)(F)CC1.
What is the InChIKey of (4,4-difluorocyclohexyl)methyl N-ethylcarbamate?
The InChIKey is NWFKFKOGXSDSKH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17F2NO2/c1-2-13-9(14)15-7-8-3-5-10(11,12)6-4-8/h8H,2-7H2,1H3,(H,13,14).
What are the key properties of (4,4-difluorocyclohexyl)methyl N-ethylcarbamate?
(4,4-difluorocyclohexyl)methyl N-ethylcarbamate has a molecular weight of 221.25 g/mol, XLogP of 2.56, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4,4-difluorocyclohexyl)methyl N-ethylcarbamate is sourced from PubChem (CID 167229449), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).