C29H32N6OS — CID 167229879
N-[[(3R)-1-[2-(3-but-3-ynyldiaziridin-3-yl)ethyl]pyrrolidin-3-yl]methyl]-2-(4-methylphenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide (PubChem CID 167229879) has the molecular formula C29H32N6OS and a molecular weight of 512.68 g/mol. Its IUPAC name is N-[[(3R)-1-[2-(3-but-3-ynyldiaziridin-3-yl)ethyl]pyrrolidin-3-yl]methyl]-2-(4-methylphenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide.
| Compound Name | N-[[(3R)-1-[2-(3-but-3-ynyldiaziridin-3-yl)ethyl]pyrrolidin-3-yl]methyl]-2-(4-methylphenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide |
|---|---|
| PubChem CID | 167229879 |
| Molecular Formula | C29H32N6OS |
| Molecular Weight | 512.68 g/mol |
| Exact Mass | 512.24 |
| IUPAC Name | N-[[(3R)-1-[2-(3-but-3-ynyldiaziridin-3-yl)ethyl]pyrrolidin-3-yl]methyl]-2-(4-methylphenyl)imidazo[2,1-b][1,3]benzothiazole-6-carboxamide |
| SMILES | C#CCCC1(CCN2CC[C@H](CNC(=O)c3ccc4c(c3)sc3nc(-c5ccc(C)cc5)cn34)C2)NN1 |
| InChI | InChI=1S/C29H32N6OS/c1-3-4-12-29(32-33-29)13-15-34-14-11-21(18-34)17-30-27(36)23-9-10-25-26(16-23)37-28-31-24(19-35(25)28)22-7-5-20(2)6-8-22/h1,5-10,16,19,21,32-33H,4,11-15,17-18H2,2H3,(H,30,36)/t21-/m1/s1 |
| InChIKey | GLYGVWSOJUMELK-OAQYLSRUSA-N |
| XLogP | 4.18 |
| TPSA | 93.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.68 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|