C15H19BrF3N3O2 — CID 167230504
tert-butyl N-[3-[[1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethylidene]amino]propyl]carbamate (PubChem CID 167230504) has the molecular formula C15H19BrF3N3O2 and a molecular weight of 410.23 g/mol. Its IUPAC name is tert-butyl N-[3-[[1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethylidene]amino]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[[1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethylidene]amino]propyl]carbamate |
|---|---|
| PubChem CID | 167230504 |
| Molecular Formula | C15H19BrF3N3O2 |
| Molecular Weight | 410.23 g/mol |
| Exact Mass | 409.06 |
| IUPAC Name | tert-butyl N-[3-[[1-(6-bromo-2-pyridinyl)-2,2,2-trifluoroethylidene]amino]propyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC/N=C(\c1cccc(Br)n1)C(F)(F)F |
| InChI | InChI=1S/C15H19BrF3N3O2/c1-14(2,3)24-13(23)21-9-5-8-20-12(15(17,18)19)10-6-4-7-11(16)22-10/h4,6-7H,5,8-9H2,1-3H3,(H,21,23)/b20-12+ |
| InChIKey | XVLDUSBQPSFYHI-UDWIEESQSA-N |
| XLogP | 4.11 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.23 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|