C19H23FN6O3 — CID 167230980
(7S,10R)-23-fluoro-11-oxa-2,4,5,13,18,24-hexazatetracyclo[18.3.1.13,6.17,10]hexacosa-1(23),3,6(26),20(24),21-pentaene-12,19-dione (PubChem CID 167230980) has the molecular formula C19H23FN6O3 and a molecular weight of 402.43 g/mol. Its IUPAC name is (7S,10R)-23-fluoro-11-oxa-2,4,5,13,18,24-hexazatetracyclo[18.3.1.13,6.17,10]hexacosa-1(23),3,6(26),20(24),21-pentaene-12,19-dione.
| Compound Name | (7S,10R)-23-fluoro-11-oxa-2,4,5,13,18,24-hexazatetracyclo[18.3.1.13,6.17,10]hexacosa-1(23),3,6(26),20(24),21-pentaene-12,19-dione |
|---|---|
| PubChem CID | 167230980 |
| Molecular Formula | C19H23FN6O3 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | (7S,10R)-23-fluoro-11-oxa-2,4,5,13,18,24-hexazatetracyclo[18.3.1.13,6.17,10]hexacosa-1(23),3,6(26),20(24),21-pentaene-12,19-dione |
| SMILES | O=C1NCCCCNC(=O)c2ccc(F)c(n2)Nc2cc([nH]n2)[C@H]2CC[C@H](C2)O1 |
| InChI | InChI=1S/C19H23FN6O3/c20-13-5-6-14-18(27)21-7-1-2-8-22-19(28)29-12-4-3-11(9-12)15-10-16(26-25-15)24-17(13)23-14/h5-6,10-12H,1-4,7-9H2,(H,21,27)(H,22,28)(H2,23,24,25,26)/t11-,12+/m0/s1 |
| InChIKey | HYGBKVKOOKJTEL-NWDGAFQWSA-N |
| XLogP | 2.57 |
| TPSA | 121.03 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |