C38H46N6O4 — CID 167231208
2-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-3-methoxyphenyl]-8-[4-[4-(2-phenylmethoxyethyl)piperazin-1-yl]benzoyl]-2,8-diazaspiro[4.5]decan-1-one (PubChem CID 167231208) has the molecular formula C38H46N6O4 and a molecular weight of 650.82 g/mol. Its IUPAC name is 2-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-3-methoxyphenyl]-8-[4-[4-(2-phenylmethoxyethyl)piperazin-1-yl]benzoyl]-2,8-diazaspiro[4.5]decan-1-one.
| Compound Name | 2-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-3-methoxyphenyl]-8-[4-[4-(2-phenylmethoxyethyl)piperazin-1-yl]benzoyl]-2,8-diazaspiro[4.5]decan-1-one |
|---|---|
| PubChem CID | 167231208 |
| Molecular Formula | C38H46N6O4 |
| Molecular Weight | 650.82 g/mol |
| Exact Mass | 650.36 |
| IUPAC Name | 2-[4-[(Z)-1-amino-3-iminoprop-1-en-2-yl]-3-methoxyphenyl]-8-[4-[4-(2-phenylmethoxyethyl)piperazin-1-yl]benzoyl]-2,8-diazaspiro[4.5]decan-1-one |
| SMILES | [H]/N=C/C(=C\N)c1ccc(N2CCC3(CCN(C(=O)c4ccc(N5CCN(CCOCc6ccccc6)CC5)cc4)CC3)C2=O)cc1OC |
| InChI | InChI=1S/C38H46N6O4/c1-47-35-25-33(11-12-34(35)31(26-39)27-40)44-18-15-38(37(44)46)13-16-43(17-14-38)36(45)30-7-9-32(10-8-30)42-21-19-41(20-22-42)23-24-48-28-29-5-3-2-4-6-29/h2-12,25-27,39H,13-24,28,40H2,1H3/b31-27+,39-26+ |
| InChIKey | NUVSURFKGDRFAU-ZXZKYKPUSA-N |
| XLogP | 4.64 |
| TPSA | 115.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.82 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|