C26H37N7O3 — CID 167231394
[(1R,3S)-3-[5-[[6-(4-aminobutoxymethyl)-2-pyridinyl]amino]-1-tert-butylpyrazol-3-yl]cyclopentyl] imidazole-1-carboxylate (PubChem CID 167231394) has the molecular formula C26H37N7O3 and a molecular weight of 495.63 g/mol. Its IUPAC name is [(1R,3S)-3-[5-[[6-(4-aminobutoxymethyl)-2-pyridinyl]amino]-1-tert-butylpyrazol-3-yl]cyclopentyl] imidazole-1-carboxylate.
| Compound Name | [(1R,3S)-3-[5-[[6-(4-aminobutoxymethyl)-2-pyridinyl]amino]-1-tert-butylpyrazol-3-yl]cyclopentyl] imidazole-1-carboxylate |
|---|---|
| PubChem CID | 167231394 |
| Molecular Formula | C26H37N7O3 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.30 |
| IUPAC Name | [(1R,3S)-3-[5-[[6-(4-aminobutoxymethyl)-2-pyridinyl]amino]-1-tert-butylpyrazol-3-yl]cyclopentyl] imidazole-1-carboxylate |
| SMILES | CC(C)(C)n1nc([C@H]2CC[C@@H](OC(=O)n3ccnc3)C2)cc1Nc1cccc(COCCCCN)n1 |
| InChI | InChI=1S/C26H37N7O3/c1-26(2,3)33-24(30-23-8-6-7-20(29-23)17-35-14-5-4-11-27)16-22(31-33)19-9-10-21(15-19)36-25(34)32-13-12-28-18-32/h6-8,12-13,16,18-19,21H,4-5,9-11,14-15,17,27H2,1-3H3,(H,29,30)/t19-,21+/m0/s1 |
| InChIKey | BQSGFOYDTCNFDM-PZJWPPBQSA-N |
| XLogP | 4.55 |
| TPSA | 122.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|