C10H13F2N — CID 167231658
(3E,5Z)-3,6-difluoro-5-prop-1-en-2-ylhepta-3,5-dien-2-imine (PubChem CID 167231658) has the molecular formula C10H13F2N and a molecular weight of 185.22 g/mol. Its IUPAC name is (3E,5Z)-3,6-difluoro-5-prop-1-en-2-ylhepta-3,5-dien-2-imine.
| Compound Name | (3E,5Z)-3,6-difluoro-5-prop-1-en-2-ylhepta-3,5-dien-2-imine |
|---|---|
| PubChem CID | 167231658 |
| Molecular Formula | C10H13F2N |
| Molecular Weight | 185.22 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | (3E,5Z)-3,6-difluoro-5-prop-1-en-2-ylhepta-3,5-dien-2-imine |
| SMILES | [H]/N=C(C)/C(F)=C/C(C(=C)C)=C(\C)F |
| InChI | InChI=1S/C10H13F2N/c1-6(2)9(7(3)11)5-10(12)8(4)13/h5,13H,1H2,2-4H3/b9-7-,10-5+,13-8+ |
| InChIKey | GREJUSJHJMBVHQ-QSIRDHQRSA-N |
| XLogP | 3.70 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.22 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|