About 3-methyl-7-propan-2-yl-4,5-dihydro-3H-azepine
3-methyl-7-propan-2-yl-4,5-dihydro-3H-azepine (PubChem CID 167231697) has the molecular formula C10H17N
and a molecular weight of 151.25 g/mol. Its IUPAC name is 3-methyl-7-propan-2-yl-4,5-dihydro-3H-azepine.
Molecular Properties
| Compound Name | 3-methyl-7-propan-2-yl-4,5-dihydro-3H-azepine |
| PubChem CID | 167231697 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | 3-methyl-7-propan-2-yl-4,5-dihydro-3H-azepine |
| SMILES | CC1C=NC(C(C)C)=CCC1 |
| InChI | InChI=1S/C10H17N/c1-8(2)10-6-4-5-9(3)7-11-10/h6-9H,4-5H2,1-3H3 |
| InChIKey | DYJNUPZZCWNHIR-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-methyl-7-propan-2-yl-4,5-dihydro-3H-azepine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methyl-7-propan-2-yl-4,5-dihydro-3H-azepine?
The IUPAC name of 3-methyl-7-propan-2-yl-4,5-dihydro-3H-azepine (CID 167231697) is 3-methyl-7-propan-2-yl-4,5-dihydro-3H-azepine.
What is the SMILES notation for 3-methyl-7-propan-2-yl-4,5-dihydro-3H-azepine?
The canonical SMILES for 3-methyl-7-propan-2-yl-4,5-dihydro-3H-azepine is CC1C=NC(C(C)C)=CCC1.
What is the InChIKey of 3-methyl-7-propan-2-yl-4,5-dihydro-3H-azepine?
The InChIKey is DYJNUPZZCWNHIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17N/c1-8(2)10-6-4-5-9(3)7-11-10/h6-9H,4-5H2,1-3H3.
What are the key properties of 3-methyl-7-propan-2-yl-4,5-dihydro-3H-azepine?
3-methyl-7-propan-2-yl-4,5-dihydro-3H-azepine has a molecular weight of 151.25 g/mol, XLogP of 3.03, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methyl-7-propan-2-yl-4,5-dihydro-3H-azepine is sourced from PubChem (CID 167231697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).