C30H29FN4S — CID 167231714
7-[4-(3-fluoro-4-prop-1-en-2-ylphenyl)phenyl]-4,5,13-trimethyl-9-(2-methylprop-2-enyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene (PubChem CID 167231714) has the molecular formula C30H29FN4S and a molecular weight of 496.66 g/mol. Its IUPAC name is 7-[4-(3-fluoro-4-prop-1-en-2-ylphenyl)phenyl]-4,5,13-trimethyl-9-(2-methylprop-2-enyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene.
| Compound Name | 7-[4-(3-fluoro-4-prop-1-en-2-ylphenyl)phenyl]-4,5,13-trimethyl-9-(2-methylprop-2-enyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
|---|---|
| PubChem CID | 167231714 |
| Molecular Formula | C30H29FN4S |
| Molecular Weight | 496.66 g/mol |
| Exact Mass | 496.21 |
| IUPAC Name | 7-[4-(3-fluoro-4-prop-1-en-2-ylphenyl)phenyl]-4,5,13-trimethyl-9-(2-methylprop-2-enyl)-3-thia-1,8,11,12-tetrazatricyclo[8.3.0.02,6]trideca-2(6),4,7,10,12-pentaene |
| SMILES | C=C(C)CC1N=C(c2ccc(-c3ccc(C(=C)C)c(F)c3)cc2)c2c(sc(C)c2C)-n2c(C)nnc21 |
| InChI | InChI=1S/C30H29FN4S/c1-16(2)14-26-29-34-33-20(7)35(29)30-27(18(5)19(6)36-30)28(32-26)22-10-8-21(9-11-22)23-12-13-24(17(3)4)25(31)15-23/h8-13,15,26H,1,3,14H2,2,4-7H3 |
| InChIKey | GUGFRLJJDOAPLP-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 43.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.66 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|