C9H10F2N2 — CID 167231755
(3Z,5Z)-6-amino-7,7-difluoro-2-methylideneocta-3,5-dienenitrile (PubChem CID 167231755) has the molecular formula C9H10F2N2 and a molecular weight of 184.19 g/mol. Its IUPAC name is (3Z,5Z)-6-amino-7,7-difluoro-2-methylideneocta-3,5-dienenitrile.
| Compound Name | (3Z,5Z)-6-amino-7,7-difluoro-2-methylideneocta-3,5-dienenitrile |
|---|---|
| PubChem CID | 167231755 |
| Molecular Formula | C9H10F2N2 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | (3Z,5Z)-6-amino-7,7-difluoro-2-methylideneocta-3,5-dienenitrile |
| SMILES | C=C(C#N)/C=C\C=C(/N)C(C)(F)F |
| InChI | InChI=1S/C9H10F2N2/c1-7(6-12)4-3-5-8(13)9(2,10)11/h3-5H,1,13H2,2H3/b4-3-,8-5- |
| InChIKey | VBLVLCHRXXTEGV-UBNNFMAXSA-N |
| XLogP | 2.12 |
| TPSA | 49.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|