C16H28O — CID 16723176
(4R,6S)-4,6-dimethyl-3,7-dimethylidene-5-prop-2-enoxynonane (PubChem CID 16723176) has the molecular formula C16H28O and a molecular weight of 236.40 g/mol. Its IUPAC name is (4R,6S)-4,6-dimethyl-3,7-dimethylidene-5-prop-2-enoxynonane.
| Compound Name | (4R,6S)-4,6-dimethyl-3,7-dimethylidene-5-prop-2-enoxynonane |
|---|---|
| PubChem CID | 16723176 |
| Molecular Formula | C16H28O |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.21 |
| IUPAC Name | (4R,6S)-4,6-dimethyl-3,7-dimethylidene-5-prop-2-enoxynonane |
| SMILES | C=CCOC([C@H](C)C(=C)CC)[C@@H](C)C(=C)CC |
| InChI | InChI=1S/C16H28O/c1-8-11-17-16(14(6)12(4)9-2)15(7)13(5)10-3/h8,14-16H,1,4-5,9-11H2,2-3,6-7H3/t14-,15+,16? |
| InChIKey | JHASOLOLIABWAQ-XYPWUTKMSA-N |
| XLogP | 4.76 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|