C19H24O5 — CID 16723195
8,9,10-trimethoxy-2-oxatetracyclo[10.5.0.01,3.06,11]heptadeca-6,8,10,16-tetraen-12-ol (PubChem CID 16723195) has the molecular formula C19H24O5 and a molecular weight of 332.40 g/mol. Its IUPAC name is 8,9,10-trimethoxy-2-oxatetracyclo[10.5.0.01,3.06,11]heptadeca-6,8,10,16-tetraen-12-ol.
| Compound Name | 8,9,10-trimethoxy-2-oxatetracyclo[10.5.0.01,3.06,11]heptadeca-6,8,10,16-tetraen-12-ol |
|---|---|
| PubChem CID | 16723195 |
| Molecular Formula | C19H24O5 |
| Molecular Weight | 332.40 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 8,9,10-trimethoxy-2-oxatetracyclo[10.5.0.01,3.06,11]heptadeca-6,8,10,16-tetraen-12-ol |
| SMILES | COc1cc2c(c(OC)c1OC)C1(O)CCCC=CC13OC3CC2 |
| InChI | InChI=1S/C19H24O5/c1-21-13-11-12-7-8-14-19(24-14)10-6-4-5-9-18(19,20)15(12)17(23-3)16(13)22-2/h6,10-11,14,20H,4-5,7-9H2,1-3H3 |
| InChIKey | QHOXSKUSZFWIEC-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|