About N-(4-cyclohexa-2,4-dien-1-ylphenyl)-4-[(1E)-hexa-1,5-dienyl]aniline
N-(4-cyclohexa-2,4-dien-1-ylphenyl)-4-[(1E)-hexa-1,5-dienyl]aniline (PubChem CID 167232097) has the molecular formula C24H25N
and a molecular weight of 327.47 g/mol. Its IUPAC name is N-(4-cyclohexa-2,4-dien-1-ylphenyl)-4-[(1E)-hexa-1,5-dienyl]aniline.
Molecular Properties
| Compound Name | N-(4-cyclohexa-2,4-dien-1-ylphenyl)-4-[(1E)-hexa-1,5-dienyl]aniline |
| PubChem CID | 167232097 |
| Molecular Formula | C24H25N |
| Molecular Weight | 327.47 g/mol |
| Exact Mass | 327.20 |
| IUPAC Name | N-(4-cyclohexa-2,4-dien-1-ylphenyl)-4-[(1E)-hexa-1,5-dienyl]aniline |
| SMILES | C=CCC/C=C/c1ccc(Nc2ccc(C3C=CC=CC3)cc2)cc1 |
| InChI | InChI=1S/C24H25N/c1-2-3-4-6-9-20-12-16-23(17-13-20)25-24-18-14-22(15-19-24)21-10-7-5-8-11-21/h2,5-10,12-19,21,25H,1,3-4,11H2/b9-6+ |
| InChIKey | ROUGJIWJNMAAPP-RMKNXTFCSA-N |
| XLogP | 7.01 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 327.47 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-(4-cyclohexa-2,4-dien-1-ylphenyl)-4-[(1E)-hexa-1,5-dienyl]aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-cyclohexa-2,4-dien-1-ylphenyl)-4-[(1E)-hexa-1,5-dienyl]aniline?
The IUPAC name of N-(4-cyclohexa-2,4-dien-1-ylphenyl)-4-[(1E)-hexa-1,5-dienyl]aniline (CID 167232097) is N-(4-cyclohexa-2,4-dien-1-ylphenyl)-4-[(1E)-hexa-1,5-dienyl]aniline.
What is the SMILES notation for N-(4-cyclohexa-2,4-dien-1-ylphenyl)-4-[(1E)-hexa-1,5-dienyl]aniline?
The canonical SMILES for N-(4-cyclohexa-2,4-dien-1-ylphenyl)-4-[(1E)-hexa-1,5-dienyl]aniline is C=CCC/C=C/c1ccc(Nc2ccc(C3C=CC=CC3)cc2)cc1.
What is the InChIKey of N-(4-cyclohexa-2,4-dien-1-ylphenyl)-4-[(1E)-hexa-1,5-dienyl]aniline?
The InChIKey is ROUGJIWJNMAAPP-RMKNXTFCSA-N. The full InChI is InChI=1S/C24H25N/c1-2-3-4-6-9-20-12-16-23(17-13-20)25-24-18-14-22(15-19-24)21-10-7-5-8-11-21/h2,5-10,12-19,21,25H,1,3-4,11H2/b9-6+.
What are the key properties of N-(4-cyclohexa-2,4-dien-1-ylphenyl)-4-[(1E)-hexa-1,5-dienyl]aniline?
N-(4-cyclohexa-2,4-dien-1-ylphenyl)-4-[(1E)-hexa-1,5-dienyl]aniline has a molecular weight of 327.47 g/mol, XLogP of 7.01, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-cyclohexa-2,4-dien-1-ylphenyl)-4-[(1E)-hexa-1,5-dienyl]aniline is sourced from PubChem (CID 167232097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).