C5H8FN3 — CID 167233258
5-fluoro-N,N-dimethyl-1H-pyrazol-4-amine (PubChem CID 167233258) has the molecular formula C5H8FN3 and a molecular weight of 129.14 g/mol. Its IUPAC name is 5-fluoro-N,N-dimethyl-1H-pyrazol-4-amine.
| Compound Name | 5-fluoro-N,N-dimethyl-1H-pyrazol-4-amine |
|---|---|
| PubChem CID | 167233258 |
| Molecular Formula | C5H8FN3 |
| Molecular Weight | 129.14 g/mol |
| Exact Mass | 129.07 |
| IUPAC Name | 5-fluoro-N,N-dimethyl-1H-pyrazol-4-amine |
| SMILES | CN(C)c1cn[nH]c1F |
| InChI | InChI=1S/C5H8FN3/c1-9(2)4-3-7-8-5(4)6/h3H,1-2H3,(H,7,8) |
| InChIKey | XTPKFWAJCLRLBG-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.14 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |