C13H27NO2 — CID 167233671
N-(6-ethoxy-3,3,5,5-tetramethylhexyl)formamide (PubChem CID 167233671) has the molecular formula C13H27NO2 and a molecular weight of 229.36 g/mol. Its IUPAC name is N-(6-ethoxy-3,3,5,5-tetramethylhexyl)formamide.
| Compound Name | N-(6-ethoxy-3,3,5,5-tetramethylhexyl)formamide |
|---|---|
| PubChem CID | 167233671 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | N-(6-ethoxy-3,3,5,5-tetramethylhexyl)formamide |
| SMILES | CCOCC(C)(C)CC(C)(C)CCNC=O |
| InChI | InChI=1S/C13H27NO2/c1-6-16-10-13(4,5)9-12(2,3)7-8-14-11-15/h11H,6-10H2,1-5H3,(H,14,15) |
| InChIKey | XWKUPCIAACHYAD-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|