C20H35NO3S — CID 167233678
N-[6-(2-ethoxyethoxy)-3,3,5,5-tetramethylhexyl]-4-methylthiophene-3-carboxamide (PubChem CID 167233678) has the molecular formula C20H35NO3S and a molecular weight of 369.57 g/mol. Its IUPAC name is N-[6-(2-ethoxyethoxy)-3,3,5,5-tetramethylhexyl]-4-methylthiophene-3-carboxamide.
| Compound Name | N-[6-(2-ethoxyethoxy)-3,3,5,5-tetramethylhexyl]-4-methylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 167233678 |
| Molecular Formula | C20H35NO3S |
| Molecular Weight | 369.57 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | N-[6-(2-ethoxyethoxy)-3,3,5,5-tetramethylhexyl]-4-methylthiophene-3-carboxamide |
| SMILES | CCOCCOCC(C)(C)CC(C)(C)CCNC(=O)c1cscc1C |
| InChI | InChI=1S/C20H35NO3S/c1-7-23-10-11-24-15-20(5,6)14-19(3,4)8-9-21-18(22)17-13-25-12-16(17)2/h12-13H,7-11,14-15H2,1-6H3,(H,21,22) |
| InChIKey | GFSWEEZSKQDFMV-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|