C18H23NO5 — CID 16723425
(1R,2S,6R,9R)-4,11,11-trimethyl-6-(phenylmethoxymethyl)-3,7,10,12-tetraoxa-5-azatricyclo[7.3.0.02,6]dodec-4-ene (PubChem CID 16723425) has the molecular formula C18H23NO5 and a molecular weight of 333.38 g/mol. Its IUPAC name is (1R,2S,6R,9R)-4,11,11-trimethyl-6-(phenylmethoxymethyl)-3,7,10,12-tetraoxa-5-azatricyclo[7.3.0.02,6]dodec-4-ene.
| Compound Name | (1R,2S,6R,9R)-4,11,11-trimethyl-6-(phenylmethoxymethyl)-3,7,10,12-tetraoxa-5-azatricyclo[7.3.0.02,6]dodec-4-ene |
|---|---|
| PubChem CID | 16723425 |
| Molecular Formula | C18H23NO5 |
| Molecular Weight | 333.38 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | (1R,2S,6R,9R)-4,11,11-trimethyl-6-(phenylmethoxymethyl)-3,7,10,12-tetraoxa-5-azatricyclo[7.3.0.02,6]dodec-4-ene |
| SMILES | CC1=N[C@]2(COCc3ccccc3)OC[C@H]3OC(C)(C)O[C@H]3[C@@H]2O1 |
| InChI | InChI=1S/C18H23NO5/c1-12-19-18(11-20-9-13-7-5-4-6-8-13)16(22-12)15-14(10-21-18)23-17(2,3)24-15/h4-8,14-16H,9-11H2,1-3H3/t14-,15-,16+,18-/m1/s1 |
| InChIKey | CHWPKDDCIYKREM-XLMAVXFVSA-N |
| XLogP | 2.27 |
| TPSA | 58.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.38 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |