C19H23NO6S — CID 16723426
[(3aR,6R,7S,7aR)-6-isothiocyanato-2,2-dimethyl-6-(phenylmethoxymethyl)-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate (PubChem CID 16723426) has the molecular formula C19H23NO6S and a molecular weight of 393.46 g/mol. Its IUPAC name is [(3aR,6R,7S,7aR)-6-isothiocyanato-2,2-dimethyl-6-(phenylmethoxymethyl)-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate.
| Compound Name | [(3aR,6R,7S,7aR)-6-isothiocyanato-2,2-dimethyl-6-(phenylmethoxymethyl)-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate |
|---|---|
| PubChem CID | 16723426 |
| Molecular Formula | C19H23NO6S |
| Molecular Weight | 393.46 g/mol |
| Exact Mass | 393.12 |
| IUPAC Name | [(3aR,6R,7S,7aR)-6-isothiocyanato-2,2-dimethyl-6-(phenylmethoxymethyl)-3a,4,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-7-yl] acetate |
| SMILES | CC(=O)O[C@H]1[C@@H]2OC(C)(C)O[C@@H]2CO[C@@]1(COCc1ccccc1)N=C=S |
| InChI | InChI=1S/C19H23NO6S/c1-13(21)24-17-16-15(25-18(2,3)26-16)10-23-19(17,20-12-27)11-22-9-14-7-5-4-6-8-14/h4-8,15-17H,9-11H2,1-3H3/t15-,16-,17+,19-/m1/s1 |
| InChIKey | UPEJOYAKJPUCDE-VXIBKDFQSA-N |
| XLogP | 2.48 |
| TPSA | 75.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.46 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|