C20H19N3O6 — CID 16723493
dimethyl (2R,3S,7S)-2-methyl-4,6-dioxo-5-phenyl-1,5,12-triazatricyclo[7.3.0.03,7]dodeca-9,11-diene-10,11-dicarboxylate (PubChem CID 16723493) has the molecular formula C20H19N3O6 and a molecular weight of 397.39 g/mol. Its IUPAC name is dimethyl (2R,3S,7S)-2-methyl-4,6-dioxo-5-phenyl-1,5,12-triazatricyclo[7.3.0.03,7]dodeca-9,11-diene-10,11-dicarboxylate.
| Compound Name | dimethyl (2R,3S,7S)-2-methyl-4,6-dioxo-5-phenyl-1,5,12-triazatricyclo[7.3.0.03,7]dodeca-9,11-diene-10,11-dicarboxylate |
|---|---|
| PubChem CID | 16723493 |
| Molecular Formula | C20H19N3O6 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.13 |
| IUPAC Name | dimethyl (2R,3S,7S)-2-methyl-4,6-dioxo-5-phenyl-1,5,12-triazatricyclo[7.3.0.03,7]dodeca-9,11-diene-10,11-dicarboxylate |
| SMILES | COC(=O)c1nn2c(c1C(=O)OC)C[C@@H]1C(=O)N(c3ccccc3)C(=O)[C@@H]1[C@H]2C |
| InChI | InChI=1S/C20H19N3O6/c1-10-14-12(17(24)22(18(14)25)11-7-5-4-6-8-11)9-13-15(19(26)28-2)16(20(27)29-3)21-23(10)13/h4-8,10,12,14H,9H2,1-3H3/t10-,12+,14-/m1/s1 |
| InChIKey | HVYCBTPLCWLSTP-SCDSUCTJSA-N |
| XLogP | 1.38 |
| TPSA | 107.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|