C15H18O3 — CID 16723533
(2S)-2-(1,3-dioxolan-2-ylmethyl)-3-methylspiro[4.5]deca-3,6,9-trien-8-one (PubChem CID 16723533) has the molecular formula C15H18O3 and a molecular weight of 246.31 g/mol. Its IUPAC name is (2S)-2-(1,3-dioxolan-2-ylmethyl)-3-methylspiro[4.5]deca-3,6,9-trien-8-one.
| Compound Name | (2S)-2-(1,3-dioxolan-2-ylmethyl)-3-methylspiro[4.5]deca-3,6,9-trien-8-one |
|---|---|
| PubChem CID | 16723533 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (2S)-2-(1,3-dioxolan-2-ylmethyl)-3-methylspiro[4.5]deca-3,6,9-trien-8-one |
| SMILES | CC1=CC2(C=CC(=O)C=C2)C[C@H]1CC1OCCO1 |
| InChI | InChI=1S/C15H18O3/c1-11-9-15(4-2-13(16)3-5-15)10-12(11)8-14-17-6-7-18-14/h2-5,9,12,14H,6-8,10H2,1H3/t12-/m1/s1 |
| InChIKey | YOLWYSCVBQIIJU-GFCCVEGCSA-N |
| XLogP | 2.40 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|