About (2-methylpropan-2-yl)oxy-(3-methyl-4-propan-2-ylthieno[2,3-b]pyrrol-6-yl)methanol
(2-methylpropan-2-yl)oxy-(3-methyl-4-propan-2-ylthieno[2,3-b]pyrrol-6-yl)methanol (PubChem CID 167236991) has the molecular formula C15H23NO2S
and a molecular weight of 281.42 g/mol. Its IUPAC name is (2-methylpropan-2-yl)oxy-(3-methyl-4-propan-2-ylthieno[2,3-b]pyrrol-6-yl)methanol.
Molecular Properties
| Compound Name | (2-methylpropan-2-yl)oxy-(3-methyl-4-propan-2-ylthieno[2,3-b]pyrrol-6-yl)methanol |
| PubChem CID | 167236991 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | (2-methylpropan-2-yl)oxy-(3-methyl-4-propan-2-ylthieno[2,3-b]pyrrol-6-yl)methanol |
| SMILES | Cc1csc2c1c(C(C)C)cn2C(O)OC(C)(C)C |
| InChI | InChI=1S/C15H23NO2S/c1-9(2)11-7-16(14(17)18-15(4,5)6)13-12(11)10(3)8-19-13/h7-9,14,17H,1-6H3 |
| InChIKey | QRNBRHMTQGGLGQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 34.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (2-methylpropan-2-yl)oxy-(3-methyl-4-propan-2-ylthieno[2,3-b]pyrrol-6-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-methylpropan-2-yl)oxy-(3-methyl-4-propan-2-ylthieno[2,3-b]pyrrol-6-yl)methanol?
The IUPAC name of (2-methylpropan-2-yl)oxy-(3-methyl-4-propan-2-ylthieno[2,3-b]pyrrol-6-yl)methanol (CID 167236991) is (2-methylpropan-2-yl)oxy-(3-methyl-4-propan-2-ylthieno[2,3-b]pyrrol-6-yl)methanol.
What is the SMILES notation for (2-methylpropan-2-yl)oxy-(3-methyl-4-propan-2-ylthieno[2,3-b]pyrrol-6-yl)methanol?
The canonical SMILES for (2-methylpropan-2-yl)oxy-(3-methyl-4-propan-2-ylthieno[2,3-b]pyrrol-6-yl)methanol is Cc1csc2c1c(C(C)C)cn2C(O)OC(C)(C)C.
What is the InChIKey of (2-methylpropan-2-yl)oxy-(3-methyl-4-propan-2-ylthieno[2,3-b]pyrrol-6-yl)methanol?
The InChIKey is QRNBRHMTQGGLGQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23NO2S/c1-9(2)11-7-16(14(17)18-15(4,5)6)13-12(11)10(3)8-19-13/h7-9,14,17H,1-6H3.
What are the key properties of (2-methylpropan-2-yl)oxy-(3-methyl-4-propan-2-ylthieno[2,3-b]pyrrol-6-yl)methanol?
(2-methylpropan-2-yl)oxy-(3-methyl-4-propan-2-ylthieno[2,3-b]pyrrol-6-yl)methanol has a molecular weight of 281.42 g/mol, XLogP of 4.40, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-methylpropan-2-yl)oxy-(3-methyl-4-propan-2-ylthieno[2,3-b]pyrrol-6-yl)methanol is sourced from PubChem (CID 167236991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).