C51H37N3 — CID 167237236
2-[(1Z)-buta-1,3-dienyl]-1-[3-[4-[4-(2,6-diphenylpyrimidin-4-yl)naphthalen-1-yl]phenyl]phenyl]-3-methylindole (PubChem CID 167237236) has the molecular formula C51H37N3 and a molecular weight of 691.88 g/mol. Its IUPAC name is 2-[(1Z)-buta-1,3-dienyl]-1-[3-[4-[4-(2,6-diphenylpyrimidin-4-yl)naphthalen-1-yl]phenyl]phenyl]-3-methylindole.
| Compound Name | 2-[(1Z)-buta-1,3-dienyl]-1-[3-[4-[4-(2,6-diphenylpyrimidin-4-yl)naphthalen-1-yl]phenyl]phenyl]-3-methylindole |
|---|---|
| PubChem CID | 167237236 |
| Molecular Formula | C51H37N3 |
| Molecular Weight | 691.88 g/mol |
| Exact Mass | 691.30 |
| IUPAC Name | 2-[(1Z)-buta-1,3-dienyl]-1-[3-[4-[4-(2,6-diphenylpyrimidin-4-yl)naphthalen-1-yl]phenyl]phenyl]-3-methylindole |
| SMILES | C=C/C=C\c1c(C)c2ccccc2n1-c1cccc(-c2ccc(-c3ccc(-c4cc(-c5ccccc5)nc(-c5ccccc5)n4)c4ccccc34)cc2)c1 |
| InChI | InChI=1S/C51H37N3/c1-3-4-25-49-35(2)42-22-13-14-26-50(42)54(49)41-21-15-20-40(33-41)36-27-29-37(30-28-36)43-31-32-46(45-24-12-11-23-44(43)45)48-34-47(38-16-7-5-8-17-38)52-51(53-48)39-18-9-6-10-19-39/h3-34H,1H2,2H3/b25-4- |
| InChIKey | LDAYOAWPORDZPY-UJOWUYHQSA-N |
| XLogP | 13.42 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 691.88 |
| LogP ≤ 5 | 13.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|