About (Z)-2,3-diamino-N'-methylbut-2-enimidamide
(Z)-2,3-diamino-N'-methylbut-2-enimidamide (PubChem CID 167237416) has the molecular formula C5H12N4
and a molecular weight of 128.18 g/mol. Its IUPAC name is (Z)-2,3-diamino-N'-methylbut-2-enimidamide.
Molecular Properties
| Compound Name | (Z)-2,3-diamino-N'-methylbut-2-enimidamide |
| PubChem CID | 167237416 |
| Molecular Formula | C5H12N4 |
| Molecular Weight | 128.18 g/mol |
| Exact Mass | 128.11 |
| IUPAC Name | (Z)-2,3-diamino-N'-methylbut-2-enimidamide |
| SMILES | C/N=C(N)/C(N)=C(\C)N |
| InChI | InChI=1S/C5H12N4/c1-3(6)4(7)5(8)9-2/h6-7H2,1-2H3,(H2,8,9)/b4-3- |
| InChIKey | XIYQJTURIQPJBT-ARJAWSKDSA-N |
| XLogP | -0.88 |
| TPSA | 90.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.18 |
| LogP ≤ 5 | -0.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2,3-diamino-N'-methylbut-2-enimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2,3-diamino-N'-methylbut-2-enimidamide?
The IUPAC name of (Z)-2,3-diamino-N'-methylbut-2-enimidamide (CID 167237416) is (Z)-2,3-diamino-N'-methylbut-2-enimidamide.
What is the SMILES notation for (Z)-2,3-diamino-N'-methylbut-2-enimidamide?
The canonical SMILES for (Z)-2,3-diamino-N'-methylbut-2-enimidamide is C/N=C(N)/C(N)=C(\C)N.
What is the InChIKey of (Z)-2,3-diamino-N'-methylbut-2-enimidamide?
The InChIKey is XIYQJTURIQPJBT-ARJAWSKDSA-N. The full InChI is InChI=1S/C5H12N4/c1-3(6)4(7)5(8)9-2/h6-7H2,1-2H3,(H2,8,9)/b4-3-.
What are the key properties of (Z)-2,3-diamino-N'-methylbut-2-enimidamide?
(Z)-2,3-diamino-N'-methylbut-2-enimidamide has a molecular weight of 128.18 g/mol, XLogP of -0.88, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2,3-diamino-N'-methylbut-2-enimidamide is sourced from PubChem (CID 167237416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).