About (Z)-6-(2,2-difluoroethoxy)hept-3-ene-2,6-diamine
(Z)-6-(2,2-difluoroethoxy)hept-3-ene-2,6-diamine (PubChem CID 167237775) has the molecular formula C9H18F2N2O
and a molecular weight of 208.25 g/mol. Its IUPAC name is (Z)-6-(2,2-difluoroethoxy)hept-3-ene-2,6-diamine.
Molecular Properties
| Compound Name | (Z)-6-(2,2-difluoroethoxy)hept-3-ene-2,6-diamine |
| PubChem CID | 167237775 |
| Molecular Formula | C9H18F2N2O |
| Molecular Weight | 208.25 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | (Z)-6-(2,2-difluoroethoxy)hept-3-ene-2,6-diamine |
| SMILES | CC(N)/C=C\CC(C)(N)OCC(F)F |
| InChI | InChI=1S/C9H18F2N2O/c1-7(12)4-3-5-9(2,13)14-6-8(10)11/h3-4,7-8H,5-6,12-13H2,1-2H3/b4-3- |
| InChIKey | BZIHFNYJDXONEU-ARJAWSKDSA-N |
| XLogP | 1.24 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 208.25 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-6-(2,2-difluoroethoxy)hept-3-ene-2,6-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-6-(2,2-difluoroethoxy)hept-3-ene-2,6-diamine?
The IUPAC name of (Z)-6-(2,2-difluoroethoxy)hept-3-ene-2,6-diamine (CID 167237775) is (Z)-6-(2,2-difluoroethoxy)hept-3-ene-2,6-diamine.
What is the SMILES notation for (Z)-6-(2,2-difluoroethoxy)hept-3-ene-2,6-diamine?
The canonical SMILES for (Z)-6-(2,2-difluoroethoxy)hept-3-ene-2,6-diamine is CC(N)/C=C\CC(C)(N)OCC(F)F.
What is the InChIKey of (Z)-6-(2,2-difluoroethoxy)hept-3-ene-2,6-diamine?
The InChIKey is BZIHFNYJDXONEU-ARJAWSKDSA-N. The full InChI is InChI=1S/C9H18F2N2O/c1-7(12)4-3-5-9(2,13)14-6-8(10)11/h3-4,7-8H,5-6,12-13H2,1-2H3/b4-3-.
What are the key properties of (Z)-6-(2,2-difluoroethoxy)hept-3-ene-2,6-diamine?
(Z)-6-(2,2-difluoroethoxy)hept-3-ene-2,6-diamine has a molecular weight of 208.25 g/mol, XLogP of 1.24, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-6-(2,2-difluoroethoxy)hept-3-ene-2,6-diamine is sourced from PubChem (CID 167237775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).