About 2-[3-(dimethylamino)-4-(ethylideneamino)phenoxy]-3,6-difluorobenzonitrile
2-[3-(dimethylamino)-4-(ethylideneamino)phenoxy]-3,6-difluorobenzonitrile (PubChem CID 167237777) has the molecular formula C17H15F2N3O
and a molecular weight of 315.32 g/mol. Its IUPAC name is 2-[3-(dimethylamino)-4-(ethylideneamino)phenoxy]-3,6-difluorobenzonitrile.
Molecular Properties
| Compound Name | 2-[3-(dimethylamino)-4-(ethylideneamino)phenoxy]-3,6-difluorobenzonitrile |
| PubChem CID | 167237777 |
| Molecular Formula | C17H15F2N3O |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.12 |
| IUPAC Name | 2-[3-(dimethylamino)-4-(ethylideneamino)phenoxy]-3,6-difluorobenzonitrile |
| SMILES | C/C=N/c1ccc(Oc2c(F)ccc(F)c2C#N)cc1N(C)C |
| InChI | InChI=1S/C17H15F2N3O/c1-4-21-15-8-5-11(9-16(15)22(2)3)23-17-12(10-20)13(18)6-7-14(17)19/h4-9H,1-3H3/b21-4+ |
| InChIKey | OSAHQDUKLCFJSS-IPBDZQFASA-N |
| XLogP | 4.42 |
| TPSA | 48.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[3-(dimethylamino)-4-(ethylideneamino)phenoxy]-3,6-difluorobenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[3-(dimethylamino)-4-(ethylideneamino)phenoxy]-3,6-difluorobenzonitrile?
The IUPAC name of 2-[3-(dimethylamino)-4-(ethylideneamino)phenoxy]-3,6-difluorobenzonitrile (CID 167237777) is 2-[3-(dimethylamino)-4-(ethylideneamino)phenoxy]-3,6-difluorobenzonitrile.
What is the SMILES notation for 2-[3-(dimethylamino)-4-(ethylideneamino)phenoxy]-3,6-difluorobenzonitrile?
The canonical SMILES for 2-[3-(dimethylamino)-4-(ethylideneamino)phenoxy]-3,6-difluorobenzonitrile is C/C=N/c1ccc(Oc2c(F)ccc(F)c2C#N)cc1N(C)C.
What is the InChIKey of 2-[3-(dimethylamino)-4-(ethylideneamino)phenoxy]-3,6-difluorobenzonitrile?
The InChIKey is OSAHQDUKLCFJSS-IPBDZQFASA-N. The full InChI is InChI=1S/C17H15F2N3O/c1-4-21-15-8-5-11(9-16(15)22(2)3)23-17-12(10-20)13(18)6-7-14(17)19/h4-9H,1-3H3/b21-4+.
What are the key properties of 2-[3-(dimethylamino)-4-(ethylideneamino)phenoxy]-3,6-difluorobenzonitrile?
2-[3-(dimethylamino)-4-(ethylideneamino)phenoxy]-3,6-difluorobenzonitrile has a molecular weight of 315.32 g/mol, XLogP of 4.42, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[3-(dimethylamino)-4-(ethylideneamino)phenoxy]-3,6-difluorobenzonitrile is sourced from PubChem (CID 167237777), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).