C14H25N — CID 167238385
(5Z)-9-ethyl-2,5,6,7-tetramethyl-3,4,7,8-tetrahydro-2H-azonine (PubChem CID 167238385) has the molecular formula C14H25N and a molecular weight of 207.36 g/mol. Its IUPAC name is (5Z)-9-ethyl-2,5,6,7-tetramethyl-3,4,7,8-tetrahydro-2H-azonine.
| Compound Name | (5Z)-9-ethyl-2,5,6,7-tetramethyl-3,4,7,8-tetrahydro-2H-azonine |
|---|---|
| PubChem CID | 167238385 |
| Molecular Formula | C14H25N |
| Molecular Weight | 207.36 g/mol |
| Exact Mass | 207.20 |
| IUPAC Name | (5Z)-9-ethyl-2,5,6,7-tetramethyl-3,4,7,8-tetrahydro-2H-azonine |
| SMILES | CC/C1=N/C(C)CC/C(C)=C(/C)C(C)C1 |
| InChI | InChI=1S/C14H25N/c1-6-14-9-11(3)13(5)10(2)7-8-12(4)15-14/h11-12H,6-9H2,1-5H3/b13-10-,15-14- |
| InChIKey | IVOREBGGPGWULL-UWBCJZLBSA-N |
| XLogP | 4.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.36 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|