C12H19NO3S — CID 167238548
4-(methylamino)-3-(2-methylbut-3-en-2-yl)cyclohexa-1,3-diene-1-sulfonic acid (PubChem CID 167238548) has the molecular formula C12H19NO3S and a molecular weight of 257.35 g/mol. Its IUPAC name is 4-(methylamino)-3-(2-methylbut-3-en-2-yl)cyclohexa-1,3-diene-1-sulfonic acid.
| Compound Name | 4-(methylamino)-3-(2-methylbut-3-en-2-yl)cyclohexa-1,3-diene-1-sulfonic acid |
|---|---|
| PubChem CID | 167238548 |
| Molecular Formula | C12H19NO3S |
| Molecular Weight | 257.35 g/mol |
| Exact Mass | 257.11 |
| IUPAC Name | 4-(methylamino)-3-(2-methylbut-3-en-2-yl)cyclohexa-1,3-diene-1-sulfonic acid |
| SMILES | C=CC(C)(C)C1=C(NC)CCC(S(=O)(=O)O)=C1 |
| InChI | InChI=1S/C12H19NO3S/c1-5-12(2,3)10-8-9(17(14,15)16)6-7-11(10)13-4/h5,8,13H,1,6-7H2,2-4H3,(H,14,15,16) |
| InChIKey | ZZJFWRNBGNIZEB-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|