About [4-(6-amino-2,5-dimethyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-amino-3-methylbutanoate
[4-(6-amino-2,5-dimethyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-amino-3-methylbutanoate (PubChem CID 167239674) has the molecular formula C18H36N2O4
and a molecular weight of 344.50 g/mol. Its IUPAC name is [4-(6-amino-2,5-dimethyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-amino-3-methylbutanoate.
Molecular Properties
| Compound Name | [4-(6-amino-2,5-dimethyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-amino-3-methylbutanoate |
| PubChem CID | 167239674 |
| Molecular Formula | C18H36N2O4 |
| Molecular Weight | 344.50 g/mol |
| Exact Mass | 344.27 |
| IUPAC Name | [4-(6-amino-2,5-dimethyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-amino-3-methylbutanoate |
| SMILES | CC(CN)CC(=O)OC(C)(C)CCOC(C)(C)C(=O)CC(C)CN |
| InChI | InChI=1S/C18H36N2O4/c1-13(11-19)9-15(21)18(5,6)23-8-7-17(3,4)24-16(22)10-14(2)12-20/h13-14H,7-12,19-20H2,1-6H3 |
| InChIKey | GAPXXCMEDRELDC-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 344.50 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(6-amino-2,5-dimethyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-amino-3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(6-amino-2,5-dimethyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-amino-3-methylbutanoate?
The IUPAC name of [4-(6-amino-2,5-dimethyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-amino-3-methylbutanoate (CID 167239674) is [4-(6-amino-2,5-dimethyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-amino-3-methylbutanoate.
What is the SMILES notation for [4-(6-amino-2,5-dimethyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-amino-3-methylbutanoate?
The canonical SMILES for [4-(6-amino-2,5-dimethyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-amino-3-methylbutanoate is CC(CN)CC(=O)OC(C)(C)CCOC(C)(C)C(=O)CC(C)CN.
What is the InChIKey of [4-(6-amino-2,5-dimethyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-amino-3-methylbutanoate?
The InChIKey is GAPXXCMEDRELDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36N2O4/c1-13(11-19)9-15(21)18(5,6)23-8-7-17(3,4)24-16(22)10-14(2)12-20/h13-14H,7-12,19-20H2,1-6H3.
What are the key properties of [4-(6-amino-2,5-dimethyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-amino-3-methylbutanoate?
[4-(6-amino-2,5-dimethyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-amino-3-methylbutanoate has a molecular weight of 344.50 g/mol, XLogP of 2.03, 12 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(6-amino-2,5-dimethyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-amino-3-methylbutanoate is sourced from PubChem (CID 167239674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).