C18H20N6O2 — CID 16723977
2-[4-[(2-methyl-4-nitroimidazol-1-yl)methyl]phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepine (PubChem CID 16723977) has the molecular formula C18H20N6O2 and a molecular weight of 352.40 g/mol. Its IUPAC name is 2-[4-[(2-methyl-4-nitroimidazol-1-yl)methyl]phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepine.
| Compound Name | 2-[4-[(2-methyl-4-nitroimidazol-1-yl)methyl]phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepine |
|---|---|
| PubChem CID | 16723977 |
| Molecular Formula | C18H20N6O2 |
| Molecular Weight | 352.40 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-[4-[(2-methyl-4-nitroimidazol-1-yl)methyl]phenyl]-6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[1,5-a]azepine |
| SMILES | Cc1nc([N+](=O)[O-])cn1Cc1ccc(-c2nc3n(n2)CCCCC3)cc1 |
| InChI | InChI=1S/C18H20N6O2/c1-13-19-17(24(25)26)12-22(13)11-14-6-8-15(9-7-14)18-20-16-5-3-2-4-10-23(16)21-18/h6-9,12H,2-5,10-11H2,1H3 |
| InChIKey | UFVBNPGGLWOJSU-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 91.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.40 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|