About [4-(6-amino-2-methyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-aminobutanoate
[4-(6-amino-2-methyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-aminobutanoate (PubChem CID 167239909) has the molecular formula C16H32N2O4
and a molecular weight of 316.44 g/mol. Its IUPAC name is [4-(6-amino-2-methyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-aminobutanoate.
Molecular Properties
| Compound Name | [4-(6-amino-2-methyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-aminobutanoate |
| PubChem CID | 167239909 |
| Molecular Formula | C16H32N2O4 |
| Molecular Weight | 316.44 g/mol |
| Exact Mass | 316.24 |
| IUPAC Name | [4-(6-amino-2-methyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-aminobutanoate |
| SMILES | CC(C)(CCOC(C)(C)C(=O)CCCN)OC(=O)CCCN |
| InChI | InChI=1S/C16H32N2O4/c1-15(2,22-14(20)8-6-11-18)9-12-21-16(3,4)13(19)7-5-10-17/h5-12,17-18H2,1-4H3 |
| InChIKey | PJAOBODLYOWRRB-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 104.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.44 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze [4-(6-amino-2-methyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-aminobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(6-amino-2-methyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-aminobutanoate?
The IUPAC name of [4-(6-amino-2-methyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-aminobutanoate (CID 167239909) is [4-(6-amino-2-methyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-aminobutanoate.
What is the SMILES notation for [4-(6-amino-2-methyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-aminobutanoate?
The canonical SMILES for [4-(6-amino-2-methyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-aminobutanoate is CC(C)(CCOC(C)(C)C(=O)CCCN)OC(=O)CCCN.
What is the InChIKey of [4-(6-amino-2-methyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-aminobutanoate?
The InChIKey is PJAOBODLYOWRRB-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32N2O4/c1-15(2,22-14(20)8-6-11-18)9-12-21-16(3,4)13(19)7-5-10-17/h5-12,17-18H2,1-4H3.
What are the key properties of [4-(6-amino-2-methyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-aminobutanoate?
[4-(6-amino-2-methyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-aminobutanoate has a molecular weight of 316.44 g/mol, XLogP of 1.54, 12 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(6-amino-2-methyl-3-oxohexan-2-yl)oxy-2-methylbutan-2-yl] 4-aminobutanoate is sourced from PubChem (CID 167239909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).