C15H26O4 — CID 167240183
2,2,4,6,8-pentamethyl-5-methylidenenonanedioic acid (PubChem CID 167240183) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is 2,2,4,6,8-pentamethyl-5-methylidenenonanedioic acid.
| Compound Name | 2,2,4,6,8-pentamethyl-5-methylidenenonanedioic acid |
|---|---|
| PubChem CID | 167240183 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | 2,2,4,6,8-pentamethyl-5-methylidenenonanedioic acid |
| SMILES | C=C(C(C)CC(C)C(=O)O)C(C)CC(C)(C)C(=O)O |
| InChI | InChI=1S/C15H26O4/c1-9(7-10(2)13(16)17)12(4)11(3)8-15(5,6)14(18)19/h9-11H,4,7-8H2,1-3,5-6H3,(H,16,17)(H,18,19) |
| InChIKey | KTMJTWIBLVELHC-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|