C10H14O2 — CID 16724096
(5S)-5-prop-2-enylcycloheptane-1,4-dione (PubChem CID 16724096) has the molecular formula C10H14O2 and a molecular weight of 166.22 g/mol. Its IUPAC name is (5S)-5-prop-2-enylcycloheptane-1,4-dione.
| Compound Name | (5S)-5-prop-2-enylcycloheptane-1,4-dione |
|---|---|
| PubChem CID | 16724096 |
| Molecular Formula | C10H14O2 |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.10 |
| IUPAC Name | (5S)-5-prop-2-enylcycloheptane-1,4-dione |
| SMILES | C=CC[C@@H]1CCC(=O)CCC1=O |
| InChI | InChI=1S/C10H14O2/c1-2-3-8-4-5-9(11)6-7-10(8)12/h2,8H,1,3-7H2/t8-/m1/s1 |
| InChIKey | WTHAUSZVUGITAU-MRVPVSSYSA-N |
| XLogP | 1.89 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|